C16H11FN4O3 — CID 9084736
2-fluoro-N'-[4-(1,3,4-oxadiazol-2-yl)benzoyl]benzohydrazide (PubChem CID 9084736) has the molecular formula C16H11FN4O3 and a molecular weight of 326.29 g/mol. Its IUPAC name is 2-fluoro-N'-[4-(1,3,4-oxadiazol-2-yl)benzoyl]benzohydrazide.
| Compound Name | 2-fluoro-N'-[4-(1,3,4-oxadiazol-2-yl)benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 9084736 |
| Molecular Formula | C16H11FN4O3 |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 2-fluoro-N'-[4-(1,3,4-oxadiazol-2-yl)benzoyl]benzohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1F)c1ccc(-c2nnco2)cc1 |
| InChI | InChI=1S/C16H11FN4O3/c17-13-4-2-1-3-12(13)15(23)20-19-14(22)10-5-7-11(8-6-10)16-21-18-9-24-16/h1-9H,(H,19,22)(H,20,23) |
| InChIKey | NJSLHHBMZJVROU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|