C23H17FN4O3 — CID 134031148
2-fluoro-N'-[4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]benzoyl]benzohydrazide (PubChem CID 134031148) has the molecular formula C23H17FN4O3 and a molecular weight of 416.41 g/mol. Its IUPAC name is 2-fluoro-N'-[4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]benzoyl]benzohydrazide.
| Compound Name | 2-fluoro-N'-[4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 134031148 |
| Molecular Formula | C23H17FN4O3 |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-fluoro-N'-[4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]benzoyl]benzohydrazide |
| SMILES | Cc1ccc(-c2nnc(-c3ccc(C(=O)NNC(=O)c4ccccc4F)cc3)o2)cc1 |
| InChI | InChI=1S/C23H17FN4O3/c1-14-6-8-16(9-7-14)22-27-28-23(31-22)17-12-10-15(11-13-17)20(29)25-26-21(30)18-4-2-3-5-19(18)24/h2-13H,1H3,(H,25,29)(H,26,30) |
| InChIKey | SDIRYLPCSKSNGN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|