C21H23N3O2 — CID 17495617
4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-N-pentan-3-ylbenzamide (PubChem CID 17495617) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-N-pentan-3-ylbenzamide.
| Compound Name | 4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-N-pentan-3-ylbenzamide |
|---|---|
| PubChem CID | 17495617 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 4-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-N-pentan-3-ylbenzamide |
| SMILES | CCC(CC)NC(=O)c1ccc(-c2nnc(-c3ccc(C)cc3)o2)cc1 |
| InChI | InChI=1S/C21H23N3O2/c1-4-18(5-2)22-19(25)15-10-12-17(13-11-15)21-24-23-20(26-21)16-8-6-14(3)7-9-16/h6-13,18H,4-5H2,1-3H3,(H,22,25) |
| InChIKey | ZNUTVHQEWKRTPL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |