C25H21ClN4O3 — CID 55659481
2-chloro-N-[2-[[4-[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]benzoyl]amino]ethyl]benzamide (PubChem CID 55659481) has the molecular formula C25H21ClN4O3 and a molecular weight of 460.92 g/mol. Its IUPAC name is 2-chloro-N-[2-[[4-[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]benzoyl]amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[[4-[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]benzoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 55659481 |
| Molecular Formula | C25H21ClN4O3 |
| Molecular Weight | 460.92 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 2-chloro-N-[2-[[4-[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]benzoyl]amino]ethyl]benzamide |
| SMILES | Cc1cccc(-c2nnc(-c3ccc(C(=O)NCCNC(=O)c4ccccc4Cl)cc3)o2)c1 |
| InChI | InChI=1S/C25H21ClN4O3/c1-16-5-4-6-19(15-16)25-30-29-24(33-25)18-11-9-17(10-12-18)22(31)27-13-14-28-23(32)20-7-2-3-8-21(20)26/h2-12,15H,13-14H2,1H3,(H,27,31)(H,28,32) |
| InChIKey | IBATWLAYIWCZQM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.92 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|