C25H23N3O4 — CID 46558814
N-[2-(2-methoxyphenoxy)ethyl]-4-[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]benzamide (PubChem CID 46558814) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is N-[2-(2-methoxyphenoxy)ethyl]-4-[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]benzamide.
| Compound Name | N-[2-(2-methoxyphenoxy)ethyl]-4-[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 46558814 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | N-[2-(2-methoxyphenoxy)ethyl]-4-[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]benzamide |
| SMILES | COc1ccccc1OCCNC(=O)c1ccc(-c2nnc(-c3cccc(C)c3)o2)cc1 |
| InChI | InChI=1S/C25H23N3O4/c1-17-6-5-7-20(16-17)25-28-27-24(32-25)19-12-10-18(11-13-19)23(29)26-14-15-31-22-9-4-3-8-21(22)30-2/h3-13,16H,14-15H2,1-2H3,(H,26,29) |
| InChIKey | ZLMWCZXEEOXVQI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|