C27H26N4O3 — CID 46320745
N-[2-(2-methoxyphenoxy)ethyl]-4-[[6-(4-methylphenyl)pyridazin-3-yl]amino]benzamide (PubChem CID 46320745) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is N-[2-(2-methoxyphenoxy)ethyl]-4-[[6-(4-methylphenyl)pyridazin-3-yl]amino]benzamide.
| Compound Name | N-[2-(2-methoxyphenoxy)ethyl]-4-[[6-(4-methylphenyl)pyridazin-3-yl]amino]benzamide |
|---|---|
| PubChem CID | 46320745 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | N-[2-(2-methoxyphenoxy)ethyl]-4-[[6-(4-methylphenyl)pyridazin-3-yl]amino]benzamide |
| SMILES | COc1ccccc1OCCNC(=O)c1ccc(Nc2ccc(-c3ccc(C)cc3)nn2)cc1 |
| InChI | InChI=1S/C27H26N4O3/c1-19-7-9-20(10-8-19)23-15-16-26(31-30-23)29-22-13-11-21(12-14-22)27(32)28-17-18-34-25-6-4-3-5-24(25)33-2/h3-16H,17-18H2,1-2H3,(H,28,32)(H,29,31) |
| InChIKey | JCHHBSPAOWNUFL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|