C25H22N4O3 — CID 50777051
N-(2,4-dimethoxyphenyl)-4-[(6-phenylpyridazin-3-yl)amino]benzamide (PubChem CID 50777051) has the molecular formula C25H22N4O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-4-[(6-phenylpyridazin-3-yl)amino]benzamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-4-[(6-phenylpyridazin-3-yl)amino]benzamide |
|---|---|
| PubChem CID | 50777051 |
| Molecular Formula | C25H22N4O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-4-[(6-phenylpyridazin-3-yl)amino]benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(Nc3ccc(-c4ccccc4)nn3)cc2)c(OC)c1 |
| InChI | InChI=1S/C25H22N4O3/c1-31-20-12-13-22(23(16-20)32-2)27-25(30)18-8-10-19(11-9-18)26-24-15-14-21(28-29-24)17-6-4-3-5-7-17/h3-16H,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | IIZZZCZDYGDZKT-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |