C30H24N4O2 — CID 46320741
4-[[6-(4-methylphenyl)pyridazin-3-yl]amino]-N-(4-phenoxyphenyl)benzamide (PubChem CID 46320741) has the molecular formula C30H24N4O2 and a molecular weight of 472.55 g/mol. Its IUPAC name is 4-[[6-(4-methylphenyl)pyridazin-3-yl]amino]-N-(4-phenoxyphenyl)benzamide.
| Compound Name | 4-[[6-(4-methylphenyl)pyridazin-3-yl]amino]-N-(4-phenoxyphenyl)benzamide |
|---|---|
| PubChem CID | 46320741 |
| Molecular Formula | C30H24N4O2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 4-[[6-(4-methylphenyl)pyridazin-3-yl]amino]-N-(4-phenoxyphenyl)benzamide |
| SMILES | Cc1ccc(-c2ccc(Nc3ccc(C(=O)Nc4ccc(Oc5ccccc5)cc4)cc3)nn2)cc1 |
| InChI | InChI=1S/C30H24N4O2/c1-21-7-9-22(10-8-21)28-19-20-29(34-33-28)31-24-13-11-23(12-14-24)30(35)32-25-15-17-27(18-16-25)36-26-5-3-2-4-6-26/h2-20H,1H3,(H,31,34)(H,32,35) |
| InChIKey | UCELCWPVTAQWOK-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |