C28H24N4O4 — CID 89169855
methyl 4-[1-[2-[4-[5-(4-prop-1-en-2-ylphenyl)-1,3,4-oxadiazol-2-yl]benzoyl]hydrazinyl]ethenyl]benzoate (PubChem CID 89169855) has the molecular formula C28H24N4O4 and a molecular weight of 480.52 g/mol. Its IUPAC name is methyl 4-[1-[2-[4-[5-(4-prop-1-en-2-ylphenyl)-1,3,4-oxadiazol-2-yl]benzoyl]hydrazinyl]ethenyl]benzoate.
| Compound Name | methyl 4-[1-[2-[4-[5-(4-prop-1-en-2-ylphenyl)-1,3,4-oxadiazol-2-yl]benzoyl]hydrazinyl]ethenyl]benzoate |
|---|---|
| PubChem CID | 89169855 |
| Molecular Formula | C28H24N4O4 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | methyl 4-[1-[2-[4-[5-(4-prop-1-en-2-ylphenyl)-1,3,4-oxadiazol-2-yl]benzoyl]hydrazinyl]ethenyl]benzoate |
| SMILES | C=C(C)c1ccc(-c2nnc(-c3ccc(C(=O)NNC(=C)c4ccc(C(=O)OC)cc4)cc3)o2)cc1 |
| InChI | InChI=1S/C28H24N4O4/c1-17(2)19-5-11-22(12-6-19)26-31-32-27(36-26)23-13-9-21(10-14-23)25(33)30-29-18(3)20-7-15-24(16-8-20)28(34)35-4/h5-16,29H,1,3H2,2,4H3,(H,30,33) |
| InChIKey | NZJCWFYLTMRCBL-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|