C21H21NO3 — CID 164863176
methyl 4-[5-(4-tert-butylphenyl)-1,3-oxazol-2-yl]benzoate (PubChem CID 164863176) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is methyl 4-[5-(4-tert-butylphenyl)-1,3-oxazol-2-yl]benzoate.
| Compound Name | methyl 4-[5-(4-tert-butylphenyl)-1,3-oxazol-2-yl]benzoate |
|---|---|
| PubChem CID | 164863176 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | methyl 4-[5-(4-tert-butylphenyl)-1,3-oxazol-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ncc(-c3ccc(C(C)(C)C)cc3)o2)cc1 |
| InChI | InChI=1S/C21H21NO3/c1-21(2,3)17-11-9-14(10-12-17)18-13-22-19(25-18)15-5-7-16(8-6-15)20(23)24-4/h5-13H,1-4H3 |
| InChIKey | GCGBIAJAGSNLQI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |