C17H23NO — CID 101479492
5-tert-butyl-2-(4-tert-butylphenyl)-1,3-oxazole (PubChem CID 101479492) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 5-tert-butyl-2-(4-tert-butylphenyl)-1,3-oxazole.
| Compound Name | 5-tert-butyl-2-(4-tert-butylphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 101479492 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 5-tert-butyl-2-(4-tert-butylphenyl)-1,3-oxazole |
| SMILES | CC(C)(C)c1ccc(-c2ncc(C(C)(C)C)o2)cc1 |
| InChI | InChI=1S/C17H23NO/c1-16(2,3)13-9-7-12(8-10-13)15-18-11-14(19-15)17(4,5)6/h7-11H,1-6H3 |
| InChIKey | NSXRHKQKBMOBOA-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |