C20H21NO — CID 171457388
5-(4-tert-butylphenyl)-2-(4-methylphenyl)-1,3-oxazole (PubChem CID 171457388) has the molecular formula C20H21NO and a molecular weight of 291.39 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-2-(4-methylphenyl)-1,3-oxazole.
| Compound Name | 5-(4-tert-butylphenyl)-2-(4-methylphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 171457388 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 5-(4-tert-butylphenyl)-2-(4-methylphenyl)-1,3-oxazole |
| SMILES | Cc1ccc(-c2ncc(-c3ccc(C(C)(C)C)cc3)o2)cc1 |
| InChI | InChI=1S/C20H21NO/c1-14-5-7-16(8-6-14)19-21-13-18(22-19)15-9-11-17(12-10-15)20(2,3)4/h5-13H,1-4H3 |
| InChIKey | NNZUJDNWHJONHV-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |