C15H11N7O+2 — CID 91738493
imino-[4-[2-[4-(iminoazaniumylideneamino)phenyl]-1,3-oxazol-5-yl]phenyl]iminoazanium (PubChem CID 91738493) has the molecular formula C15H11N7O+2 and a molecular weight of 305.30 g/mol. Its IUPAC name is imino-[4-[2-[4-(iminoazaniumylideneamino)phenyl]-1,3-oxazol-5-yl]phenyl]iminoazanium.
| Compound Name | imino-[4-[2-[4-(iminoazaniumylideneamino)phenyl]-1,3-oxazol-5-yl]phenyl]iminoazanium |
|---|---|
| PubChem CID | 91738493 |
| Molecular Formula | C15H11N7O+2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | imino-[4-[2-[4-(iminoazaniumylideneamino)phenyl]-1,3-oxazol-5-yl]phenyl]iminoazanium |
| SMILES | N=[N+]=Nc1ccc(-c2cnc(-c3ccc(N=[N+]=N)cc3)o2)cc1 |
| InChI | InChI=1S/C15H11N7O/c16-21-19-12-5-1-10(2-6-12)14-9-18-15(23-14)11-3-7-13(8-4-11)20-22-17/h1-9,16-17H/q+2 |
| InChIKey | HVAZMCGGMRNWIQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|