C20H19N3O5 — CID 21105769
methyl 4-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]-3-nitrobenzoate (PubChem CID 21105769) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is methyl 4-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]-3-nitrobenzoate.
| Compound Name | methyl 4-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 21105769 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | methyl 4-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]-3-nitrobenzoate |
| SMILES | COC(=O)c1ccc(-c2nnc(-c3ccc(C(C)(C)C)cc3)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H19N3O5/c1-20(2,3)14-8-5-12(6-9-14)17-21-22-18(28-17)15-10-7-13(19(24)27-4)11-16(15)23(25)26/h5-11H,1-4H3 |
| InChIKey | BSELARZKSGPQED-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|