C28H26N4O5 — CID 58104897
[4-[[[4-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]benzoyl]amino]carbamoyl]phenyl] acetate (PubChem CID 58104897) has the molecular formula C28H26N4O5 and a molecular weight of 498.54 g/mol. Its IUPAC name is [4-[[[4-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]benzoyl]amino]carbamoyl]phenyl] acetate.
| Compound Name | [4-[[[4-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]benzoyl]amino]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 58104897 |
| Molecular Formula | C28H26N4O5 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | [4-[[[4-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]benzoyl]amino]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)NNC(=O)c2ccc(-c3nnc(-c4ccc(C(C)(C)C)cc4)o3)cc2)cc1 |
| InChI | InChI=1S/C28H26N4O5/c1-17(33)36-23-15-11-19(12-16-23)25(35)30-29-24(34)18-5-7-20(8-6-18)26-31-32-27(37-26)21-9-13-22(14-10-21)28(2,3)4/h5-16H,1-4H3,(H,29,34)(H,30,35) |
| InChIKey | FHCMEDMQOOKGCX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|