C28H26N4O5 — CID 174608636
[[3-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]benzoyl]amino]carbamoyl 2-phenylacetate (PubChem CID 174608636) has the molecular formula C28H26N4O5 and a molecular weight of 498.54 g/mol. Its IUPAC name is [[3-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]benzoyl]amino]carbamoyl 2-phenylacetate.
| Compound Name | [[3-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]benzoyl]amino]carbamoyl 2-phenylacetate |
|---|---|
| PubChem CID | 174608636 |
| Molecular Formula | C28H26N4O5 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | [[3-[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]benzoyl]amino]carbamoyl 2-phenylacetate |
| SMILES | CC(C)(C)c1ccc(-c2nnc(-c3cccc(C(=O)NNC(=O)OC(=O)Cc4ccccc4)c3)o2)cc1 |
| InChI | InChI=1S/C28H26N4O5/c1-28(2,3)22-14-12-19(13-15-22)25-30-31-26(37-25)21-11-7-10-20(17-21)24(34)29-32-27(35)36-23(33)16-18-8-5-4-6-9-18/h4-15,17H,16H2,1-3H3,(H,29,34)(H,32,35) |
| InChIKey | OUSYCNQHYKODEX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|