C18H19N5O3S — CID 39040917
1-(4-methylphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]triazole-4-carboxamide (PubChem CID 39040917) has the molecular formula C18H19N5O3S and a molecular weight of 385.45 g/mol. Its IUPAC name is 1-(4-methylphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]triazole-4-carboxamide.
| Compound Name | 1-(4-methylphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 39040917 |
| Molecular Formula | C18H19N5O3S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 1-(4-methylphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]triazole-4-carboxamide |
| SMILES | Cc1ccc(-n2cc(C(=O)NCCc3ccc(S(N)(=O)=O)cc3)nn2)cc1 |
| InChI | InChI=1S/C18H19N5O3S/c1-13-2-6-15(7-3-13)23-12-17(21-22-23)18(24)20-11-10-14-4-8-16(9-5-14)27(19,25)26/h2-9,12H,10-11H2,1H3,(H,20,24)(H2,19,25,26) |
| InChIKey | JGZOELBFDNAGSG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |