C15H16N6O — CID 86830436
1-(4-methylphenyl)-N-[(1-methylpyrazol-4-yl)methyl]triazole-4-carboxamide (PubChem CID 86830436) has the molecular formula C15H16N6O and a molecular weight of 296.33 g/mol. Its IUPAC name is 1-(4-methylphenyl)-N-[(1-methylpyrazol-4-yl)methyl]triazole-4-carboxamide.
| Compound Name | 1-(4-methylphenyl)-N-[(1-methylpyrazol-4-yl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 86830436 |
| Molecular Formula | C15H16N6O |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 1-(4-methylphenyl)-N-[(1-methylpyrazol-4-yl)methyl]triazole-4-carboxamide |
| SMILES | Cc1ccc(-n2cc(C(=O)NCc3cnn(C)c3)nn2)cc1 |
| InChI | InChI=1S/C15H16N6O/c1-11-3-5-13(6-4-11)21-10-14(18-19-21)15(22)16-7-12-8-17-20(2)9-12/h3-6,8-10H,7H2,1-2H3,(H,16,22) |
| InChIKey | LJMBUMQAERBIQO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |