C13H18ClN5O — CID 119405590
N-(3-aminopropyl)-1-(4-methylphenyl)triazole-4-carboxamide;hydrochloride (PubChem CID 119405590) has the molecular formula C13H18ClN5O and a molecular weight of 295.77 g/mol. Its IUPAC name is N-(3-aminopropyl)-1-(4-methylphenyl)triazole-4-carboxamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-1-(4-methylphenyl)triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119405590 |
| Molecular Formula | C13H18ClN5O |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N-(3-aminopropyl)-1-(4-methylphenyl)triazole-4-carboxamide;hydrochloride |
| SMILES | Cc1ccc(-n2cc(C(=O)NCCCN)nn2)cc1.Cl |
| InChI | InChI=1S/C13H17N5O.ClH/c1-10-3-5-11(6-4-10)18-9-12(16-17-18)13(19)15-8-2-7-14;/h3-6,9H,2,7-8,14H2,1H3,(H,15,19);1H |
| InChIKey | VAPODUYEODAMNT-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|