C16H20F3N5O — CID 86991560
1-(4-methylphenyl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]triazole-4-carboxamide (PubChem CID 86991560) has the molecular formula C16H20F3N5O and a molecular weight of 355.36 g/mol. Its IUPAC name is 1-(4-methylphenyl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]triazole-4-carboxamide.
| Compound Name | 1-(4-methylphenyl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 86991560 |
| Molecular Formula | C16H20F3N5O |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 1-(4-methylphenyl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]triazole-4-carboxamide |
| SMILES | Cc1ccc(-n2cc(C(=O)NCCCN(C)CC(F)(F)F)nn2)cc1 |
| InChI | InChI=1S/C16H20F3N5O/c1-12-4-6-13(7-5-12)24-10-14(21-22-24)15(25)20-8-3-9-23(2)11-16(17,18)19/h4-7,10H,3,8-9,11H2,1-2H3,(H,20,25) |
| InChIKey | OMHNUTUWBUZZHV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|