C13H16N4O2 — CID 106843500
N-(4-hydroxybutyl)-1-phenyltriazole-4-carboxamide (PubChem CID 106843500) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is N-(4-hydroxybutyl)-1-phenyltriazole-4-carboxamide.
| Compound Name | N-(4-hydroxybutyl)-1-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 106843500 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | N-(4-hydroxybutyl)-1-phenyltriazole-4-carboxamide |
| SMILES | O=C(NCCCCO)c1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C13H16N4O2/c18-9-5-4-8-14-13(19)12-10-17(16-15-12)11-6-2-1-3-7-11/h1-3,6-7,10,18H,4-5,8-9H2,(H,14,19) |
| InChIKey | LVDALNOJIXHGIA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|