C13H16N4O3 — CID 66169267
N-(2,3-dihydroxy-2-methylpropyl)-1-phenyltriazole-4-carboxamide (PubChem CID 66169267) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is N-(2,3-dihydroxy-2-methylpropyl)-1-phenyltriazole-4-carboxamide.
| Compound Name | N-(2,3-dihydroxy-2-methylpropyl)-1-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 66169267 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | N-(2,3-dihydroxy-2-methylpropyl)-1-phenyltriazole-4-carboxamide |
| SMILES | CC(O)(CO)CNC(=O)c1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C13H16N4O3/c1-13(20,9-18)8-14-12(19)11-7-17(16-15-11)10-5-3-2-4-6-10/h2-7,18,20H,8-9H2,1H3,(H,14,19) |
| InChIKey | BFVIUHDXHJIZMO-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |