C13H14N4O3 — CID 43360787
3-[(1-phenyltriazole-4-carbonyl)amino]butanoic acid (PubChem CID 43360787) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is 3-[(1-phenyltriazole-4-carbonyl)amino]butanoic acid.
| Compound Name | 3-[(1-phenyltriazole-4-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 43360787 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 3-[(1-phenyltriazole-4-carbonyl)amino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)c1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C13H14N4O3/c1-9(7-12(18)19)14-13(20)11-8-17(16-15-11)10-5-3-2-4-6-10/h2-6,8-9H,7H2,1H3,(H,14,20)(H,18,19) |
| InChIKey | BPWOXPMWEJJOBV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |