C13H15FN4O — CID 95086934
N-[(2R)-butan-2-yl]-1-(3-fluorophenyl)triazole-4-carboxamide (PubChem CID 95086934) has the molecular formula C13H15FN4O and a molecular weight of 262.29 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-1-(3-fluorophenyl)triazole-4-carboxamide.
| Compound Name | N-[(2R)-butan-2-yl]-1-(3-fluorophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 95086934 |
| Molecular Formula | C13H15FN4O |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | N-[(2R)-butan-2-yl]-1-(3-fluorophenyl)triazole-4-carboxamide |
| SMILES | CC[C@@H](C)NC(=O)c1cn(-c2cccc(F)c2)nn1 |
| InChI | InChI=1S/C13H15FN4O/c1-3-9(2)15-13(19)12-8-18(17-16-12)11-6-4-5-10(14)7-11/h4-9H,3H2,1-2H3,(H,15,19)/t9-/m1/s1 |
| InChIKey | CHFRLAWQANVCGB-SECBINFHSA-N |
| XLogP | 1.93 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |