C12H15ClN6O3 — CID 120505264
N-[(2S)-1-aminopropan-2-yl]-1-(3-nitrophenyl)triazole-4-carboxamide;hydrochloride (PubChem CID 120505264) has the molecular formula C12H15ClN6O3 and a molecular weight of 326.74 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-1-(3-nitrophenyl)triazole-4-carboxamide;hydrochloride.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-1-(3-nitrophenyl)triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120505264 |
| Molecular Formula | C12H15ClN6O3 |
| Molecular Weight | 326.74 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-1-(3-nitrophenyl)triazole-4-carboxamide;hydrochloride |
| SMILES | C[C@@H](CN)NC(=O)c1cn(-c2cccc([N+](=O)[O-])c2)nn1.Cl |
| InChI | InChI=1S/C12H14N6O3.ClH/c1-8(6-13)14-12(19)11-7-17(16-15-11)9-3-2-4-10(5-9)18(20)21;/h2-5,7-8H,6,13H2,1H3,(H,14,19);1H/t8-;/m0./s1 |
| InChIKey | IABMZKLWFMFYNQ-QRPNPIFTSA-N |
| XLogP | 0.67 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.74 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|