C13H14N6O3 — CID 119453027
1-(3-nitrophenyl)-N-pyrrolidin-3-yltriazole-4-carboxamide (PubChem CID 119453027) has the molecular formula C13H14N6O3 and a molecular weight of 302.29 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-N-pyrrolidin-3-yltriazole-4-carboxamide.
| Compound Name | 1-(3-nitrophenyl)-N-pyrrolidin-3-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119453027 |
| Molecular Formula | C13H14N6O3 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 1-(3-nitrophenyl)-N-pyrrolidin-3-yltriazole-4-carboxamide |
| SMILES | O=C(NC1CCNC1)c1cn(-c2cccc([N+](=O)[O-])c2)nn1 |
| InChI | InChI=1S/C13H14N6O3/c20-13(15-9-4-5-14-7-9)12-8-18(17-16-12)10-2-1-3-11(6-10)19(21)22/h1-3,6,8-9,14H,4-5,7H2,(H,15,20) |
| InChIKey | BPQAKNXDHIOXCH-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|