C17H23ClN6O3 — CID 119591325
N-(2-amino-1-cyclohexylethyl)-1-(3-nitrophenyl)triazole-4-carboxamide;hydrochloride (PubChem CID 119591325) has the molecular formula C17H23ClN6O3 and a molecular weight of 394.86 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-1-(3-nitrophenyl)triazole-4-carboxamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-1-(3-nitrophenyl)triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119591325 |
| Molecular Formula | C17H23ClN6O3 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-1-(3-nitrophenyl)triazole-4-carboxamide;hydrochloride |
| SMILES | Cl.NCC(NC(=O)c1cn(-c2cccc([N+](=O)[O-])c2)nn1)C1CCCCC1 |
| InChI | InChI=1S/C17H22N6O3.ClH/c18-10-15(12-5-2-1-3-6-12)19-17(24)16-11-22(21-20-16)13-7-4-8-14(9-13)23(25)26;/h4,7-9,11-12,15H,1-3,5-6,10,18H2,(H,19,24);1H |
| InChIKey | KPWNLAOKJSABTO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|