C18H23N5O3 — CID 119590853
N-(2-amino-1-cyclohexylethyl)-1-(3-nitrophenyl)pyrazole-3-carboxamide (PubChem CID 119590853) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-1-(3-nitrophenyl)pyrazole-3-carboxamide.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-1-(3-nitrophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 119590853 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-1-(3-nitrophenyl)pyrazole-3-carboxamide |
| SMILES | NCC(NC(=O)c1ccn(-c2cccc([N+](=O)[O-])c2)n1)C1CCCCC1 |
| InChI | InChI=1S/C18H23N5O3/c19-12-17(13-5-2-1-3-6-13)20-18(24)16-9-10-22(21-16)14-7-4-8-15(11-14)23(25)26/h4,7-11,13,17H,1-3,5-6,12,19H2,(H,20,24) |
| InChIKey | ZFOWARGSPBQEEF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|