C16H22ClN5O3 — CID 119570628
N-[3-(aminomethyl)pentan-3-yl]-1-(3-nitrophenyl)pyrazole-3-carboxamide;hydrochloride (PubChem CID 119570628) has the molecular formula C16H22ClN5O3 and a molecular weight of 367.84 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-1-(3-nitrophenyl)pyrazole-3-carboxamide;hydrochloride.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-1-(3-nitrophenyl)pyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119570628 |
| Molecular Formula | C16H22ClN5O3 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-1-(3-nitrophenyl)pyrazole-3-carboxamide;hydrochloride |
| SMILES | CCC(CC)(CN)NC(=O)c1ccn(-c2cccc([N+](=O)[O-])c2)n1.Cl |
| InChI | InChI=1S/C16H21N5O3.ClH/c1-3-16(4-2,11-17)18-15(22)14-8-9-20(19-14)12-6-5-7-13(10-12)21(23)24;/h5-10H,3-4,11,17H2,1-2H3,(H,18,22);1H |
| InChIKey | JIEPXMGVJPQDRS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|