About 1-(3-nitrophenyl)-N-[(1R,2S)-2-propylcyclopropyl]pyrazole-3-carboxamide
1-(3-nitrophenyl)-N-[(1R,2S)-2-propylcyclopropyl]pyrazole-3-carboxamide (PubChem CID 95990411) has the molecular formula C16H18N4O3
and a molecular weight of 314.35 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-N-[(1R,2S)-2-propylcyclopropyl]pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 1-(3-nitrophenyl)-N-[(1R,2S)-2-propylcyclopropyl]pyrazole-3-carboxamide |
| PubChem CID | 95990411 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 1-(3-nitrophenyl)-N-[(1R,2S)-2-propylcyclopropyl]pyrazole-3-carboxamide |
| SMILES | CCC[C@H]1C[C@H]1NC(=O)c1ccn(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C16H18N4O3/c1-2-4-11-9-15(11)17-16(21)14-7-8-19(18-14)12-5-3-6-13(10-12)20(22)23/h3,5-8,10-11,15H,2,4,9H2,1H3,(H,17,21)/t11-,15+/m0/s1 |
| InChIKey | JDQUKFHBYWOWNB-XHDPSFHLSA-N |
| XLogP | 2.70 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-nitrophenyl)-N-[(1R,2S)-2-propylcyclopropyl]pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-nitrophenyl)-N-[(1R,2S)-2-propylcyclopropyl]pyrazole-3-carboxamide?
The IUPAC name of 1-(3-nitrophenyl)-N-[(1R,2S)-2-propylcyclopropyl]pyrazole-3-carboxamide (CID 95990411) is 1-(3-nitrophenyl)-N-[(1R,2S)-2-propylcyclopropyl]pyrazole-3-carboxamide.
What is the SMILES notation for 1-(3-nitrophenyl)-N-[(1R,2S)-2-propylcyclopropyl]pyrazole-3-carboxamide?
The canonical SMILES for 1-(3-nitrophenyl)-N-[(1R,2S)-2-propylcyclopropyl]pyrazole-3-carboxamide is CCC[C@H]1C[C@H]1NC(=O)c1ccn(-c2cccc([N+](=O)[O-])c2)n1.
What is the InChIKey of 1-(3-nitrophenyl)-N-[(1R,2S)-2-propylcyclopropyl]pyrazole-3-carboxamide?
The InChIKey is JDQUKFHBYWOWNB-XHDPSFHLSA-N. The full InChI is InChI=1S/C16H18N4O3/c1-2-4-11-9-15(11)17-16(21)14-7-8-19(18-14)12-5-3-6-13(10-12)20(22)23/h3,5-8,10-11,15H,2,4,9H2,1H3,(H,17,21)/t11-,15+/m0/s1.
What are the key properties of 1-(3-nitrophenyl)-N-[(1R,2S)-2-propylcyclopropyl]pyrazole-3-carboxamide?
1-(3-nitrophenyl)-N-[(1R,2S)-2-propylcyclopropyl]pyrazole-3-carboxamide has a molecular weight of 314.35 g/mol, XLogP of 2.70, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-nitrophenyl)-N-[(1R,2S)-2-propylcyclopropyl]pyrazole-3-carboxamide is sourced from PubChem (CID 95990411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).