C16H20ClN5O3 — CID 120599281
N-(2-methylpiperidin-4-yl)-1-(3-nitrophenyl)pyrazole-3-carboxamide;hydrochloride (PubChem CID 120599281) has the molecular formula C16H20ClN5O3 and a molecular weight of 365.82 g/mol. Its IUPAC name is N-(2-methylpiperidin-4-yl)-1-(3-nitrophenyl)pyrazole-3-carboxamide;hydrochloride.
| Compound Name | N-(2-methylpiperidin-4-yl)-1-(3-nitrophenyl)pyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120599281 |
| Molecular Formula | C16H20ClN5O3 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N-(2-methylpiperidin-4-yl)-1-(3-nitrophenyl)pyrazole-3-carboxamide;hydrochloride |
| SMILES | CC1CC(NC(=O)c2ccn(-c3cccc([N+](=O)[O-])c3)n2)CCN1.Cl |
| InChI | InChI=1S/C16H19N5O3.ClH/c1-11-9-12(5-7-17-11)18-16(22)15-6-8-20(19-15)13-3-2-4-14(10-13)21(23)24;/h2-4,6,8,10-12,17H,5,7,9H2,1H3,(H,18,22);1H |
| InChIKey | KDTYEPCNELKZAR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|