C15H18ClN5O3 — CID 119552733
N-methyl-1-(3-nitrophenyl)-N-pyrrolidin-3-ylpyrazole-3-carboxamide;hydrochloride (PubChem CID 119552733) has the molecular formula C15H18ClN5O3 and a molecular weight of 351.79 g/mol. Its IUPAC name is N-methyl-1-(3-nitrophenyl)-N-pyrrolidin-3-ylpyrazole-3-carboxamide;hydrochloride.
| Compound Name | N-methyl-1-(3-nitrophenyl)-N-pyrrolidin-3-ylpyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119552733 |
| Molecular Formula | C15H18ClN5O3 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | N-methyl-1-(3-nitrophenyl)-N-pyrrolidin-3-ylpyrazole-3-carboxamide;hydrochloride |
| SMILES | CN(C(=O)c1ccn(-c2cccc([N+](=O)[O-])c2)n1)C1CCNC1.Cl |
| InChI | InChI=1S/C15H17N5O3.ClH/c1-18(13-5-7-16-10-13)15(21)14-6-8-19(17-14)11-3-2-4-12(9-11)20(22)23;/h2-4,6,8-9,13,16H,5,7,10H2,1H3;1H |
| InChIKey | ZHRBQCIESFFGQX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|