C15H18N6O3 — CID 119553182
N,5-dimethyl-1-(3-nitrophenyl)-N-pyrrolidin-3-yltriazole-4-carboxamide (PubChem CID 119553182) has the molecular formula C15H18N6O3 and a molecular weight of 330.35 g/mol. Its IUPAC name is N,5-dimethyl-1-(3-nitrophenyl)-N-pyrrolidin-3-yltriazole-4-carboxamide.
| Compound Name | N,5-dimethyl-1-(3-nitrophenyl)-N-pyrrolidin-3-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119553182 |
| Molecular Formula | C15H18N6O3 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | N,5-dimethyl-1-(3-nitrophenyl)-N-pyrrolidin-3-yltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)N(C)C2CCNC2)nnn1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H18N6O3/c1-10-14(15(22)19(2)13-6-7-16-9-13)17-18-20(10)11-4-3-5-12(8-11)21(23)24/h3-5,8,13,16H,6-7,9H2,1-2H3 |
| InChIKey | HHIUDMWTYCTMRP-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|