C16H21N5O5 — CID 55523547
N,N-bis(2-methoxyethyl)-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide (PubChem CID 55523547) has the molecular formula C16H21N5O5 and a molecular weight of 363.37 g/mol. Its IUPAC name is N,N-bis(2-methoxyethyl)-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide.
| Compound Name | N,N-bis(2-methoxyethyl)-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 55523547 |
| Molecular Formula | C16H21N5O5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N,N-bis(2-methoxyethyl)-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide |
| SMILES | COCCN(CCOC)C(=O)c1nnn(-c2cccc([N+](=O)[O-])c2)c1C |
| InChI | InChI=1S/C16H21N5O5/c1-12-15(16(22)19(7-9-25-2)8-10-26-3)17-18-20(12)13-5-4-6-14(11-13)21(23)24/h4-6,11H,7-10H2,1-3H3 |
| InChIKey | TWXDAYCCBLSXSZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 112.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|