C17H21ClN6O3 — CID 119458149
N-(8-azabicyclo[3.2.1]octan-3-yl)-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide;hydrochloride (PubChem CID 119458149) has the molecular formula C17H21ClN6O3 and a molecular weight of 392.85 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide;hydrochloride.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119458149 |
| Molecular Formula | C17H21ClN6O3 |
| Molecular Weight | 392.85 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-5-methyl-1-(3-nitrophenyl)triazole-4-carboxamide;hydrochloride |
| SMILES | Cc1c(C(=O)NC2CC3CCC(C2)N3)nnn1-c1cccc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C17H20N6O3.ClH/c1-10-16(17(24)19-13-7-11-5-6-12(8-13)18-11)20-21-22(10)14-3-2-4-15(9-14)23(25)26;/h2-4,9,11-13,18H,5-8H2,1H3,(H,19,24);1H |
| InChIKey | LWUWHJSCBUHJDW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.85 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|