C15H20ClN3O3 — CID 119455692
N-(8-azabicyclo[3.2.1]octan-3-yl)-2-methyl-5-nitrobenzamide;hydrochloride (PubChem CID 119455692) has the molecular formula C15H20ClN3O3 and a molecular weight of 325.80 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-2-methyl-5-nitrobenzamide;hydrochloride.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-2-methyl-5-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119455692 |
| Molecular Formula | C15H20ClN3O3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-2-methyl-5-nitrobenzamide;hydrochloride |
| SMILES | Cc1ccc([N+](=O)[O-])cc1C(=O)NC1CC2CCC(C1)N2.Cl |
| InChI | InChI=1S/C15H19N3O3.ClH/c1-9-2-5-13(18(20)21)8-14(9)15(19)17-12-6-10-3-4-11(7-12)16-10;/h2,5,8,10-12,16H,3-4,6-7H2,1H3,(H,17,19);1H |
| InChIKey | JZJREHNREMOUKF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|