C15H18FN3O3 — CID 119459081
N-(8-azabicyclo[3.2.1]octan-3-yl)-5-fluoro-3-methyl-2-nitrobenzamide (PubChem CID 119459081) has the molecular formula C15H18FN3O3 and a molecular weight of 307.33 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-5-fluoro-3-methyl-2-nitrobenzamide.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-5-fluoro-3-methyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 119459081 |
| Molecular Formula | C15H18FN3O3 |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-5-fluoro-3-methyl-2-nitrobenzamide |
| SMILES | Cc1cc(F)cc(C(=O)NC2CC3CCC(C2)N3)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H18FN3O3/c1-8-4-9(16)5-13(14(8)19(21)22)15(20)18-12-6-10-2-3-11(7-12)17-10/h4-5,10-12,17H,2-3,6-7H2,1H3,(H,18,20) |
| InChIKey | WFAQENJIGWSQLB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|