C16H19Cl2FN4O — CID 119456839
N-(8-azabicyclo[3.2.1]octan-3-yl)-7-fluoroquinoxaline-5-carboxamide;dihydrochloride (PubChem CID 119456839) has the molecular formula C16H19Cl2FN4O and a molecular weight of 373.26 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-7-fluoroquinoxaline-5-carboxamide;dihydrochloride.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-7-fluoroquinoxaline-5-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119456839 |
| Molecular Formula | C16H19Cl2FN4O |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-7-fluoroquinoxaline-5-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NC1CC2CCC(C1)N2)c1cc(F)cc2nccnc12 |
| InChI | InChI=1S/C16H17FN4O.2ClH/c17-9-5-13(15-14(6-9)18-3-4-19-15)16(22)21-12-7-10-1-2-11(8-12)20-10;;/h3-6,10-12,20H,1-2,7-8H2,(H,21,22);2*1H |
| InChIKey | SFHNRZOPCNFHTL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |