C17H20Cl3N3O — CID 119458232
N-(8-azabicyclo[3.2.1]octan-3-yl)-5-chloroquinoline-8-carboxamide;dihydrochloride (PubChem CID 119458232) has the molecular formula C17H20Cl3N3O and a molecular weight of 388.73 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-5-chloroquinoline-8-carboxamide;dihydrochloride.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-5-chloroquinoline-8-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119458232 |
| Molecular Formula | C17H20Cl3N3O |
| Molecular Weight | 388.73 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-5-chloroquinoline-8-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NC1CC2CCC(C1)N2)c1ccc(Cl)c2cccnc12 |
| InChI | InChI=1S/C17H18ClN3O.2ClH/c18-15-6-5-14(16-13(15)2-1-7-19-16)17(22)21-12-8-10-3-4-11(9-12)20-10;;/h1-2,5-7,10-12,20H,3-4,8-9H2,(H,21,22);2*1H |
| InChIKey | VGJRAPNRUPTHAH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.73 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |