C17H23Cl2FN4O — CID 119590226
N-(2-amino-1-cyclohexylethyl)-7-fluoroquinoxaline-5-carboxamide;dihydrochloride (PubChem CID 119590226) has the molecular formula C17H23Cl2FN4O and a molecular weight of 389.30 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-7-fluoroquinoxaline-5-carboxamide;dihydrochloride.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-7-fluoroquinoxaline-5-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119590226 |
| Molecular Formula | C17H23Cl2FN4O |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-7-fluoroquinoxaline-5-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NCC(NC(=O)c1cc(F)cc2nccnc12)C1CCCCC1 |
| InChI | InChI=1S/C17H21FN4O.2ClH/c18-12-8-13(16-14(9-12)20-6-7-21-16)17(23)22-15(10-19)11-4-2-1-3-5-11;;/h6-9,11,15H,1-5,10,19H2,(H,22,23);2*1H |
| InChIKey | JMDXOIJFVZONBM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |