C14H22Cl2FN3O — CID 119589722
N-(2-amino-1-cyclohexylethyl)-5-fluoropyridine-3-carboxamide;dihydrochloride (PubChem CID 119589722) has the molecular formula C14H22Cl2FN3O and a molecular weight of 338.25 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-5-fluoropyridine-3-carboxamide;dihydrochloride.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-5-fluoropyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119589722 |
| Molecular Formula | C14H22Cl2FN3O |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-5-fluoropyridine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NCC(NC(=O)c1cncc(F)c1)C1CCCCC1 |
| InChI | InChI=1S/C14H20FN3O.2ClH/c15-12-6-11(8-17-9-12)14(19)18-13(7-16)10-4-2-1-3-5-10;;/h6,8-10,13H,1-5,7,16H2,(H,18,19);2*1H |
| InChIKey | ABWQXYSSYBDTJR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |