C20H25N3O — CID 119590618
N-(2-amino-1-cyclohexylethyl)-5-phenylpyridine-3-carboxamide (PubChem CID 119590618) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-5-phenylpyridine-3-carboxamide.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-5-phenylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 119590618 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-5-phenylpyridine-3-carboxamide |
| SMILES | NCC(NC(=O)c1cncc(-c2ccccc2)c1)C1CCCCC1 |
| InChI | InChI=1S/C20H25N3O/c21-12-19(16-9-5-2-6-10-16)23-20(24)18-11-17(13-22-14-18)15-7-3-1-4-8-15/h1,3-4,7-8,11,13-14,16,19H,2,5-6,9-10,12,21H2,(H,23,24) |
| InChIKey | BBMMXGBMQJULAX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |