C13H21ClFN3O2S — CID 119983682
N-(2-amino-1-cyclohexylethyl)-5-fluoropyridine-3-sulfonamide;hydrochloride (PubChem CID 119983682) has the molecular formula C13H21ClFN3O2S and a molecular weight of 337.85 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-5-fluoropyridine-3-sulfonamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-5-fluoropyridine-3-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119983682 |
| Molecular Formula | C13H21ClFN3O2S |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-5-fluoropyridine-3-sulfonamide;hydrochloride |
| SMILES | Cl.NCC(NS(=O)(=O)c1cncc(F)c1)C1CCCCC1 |
| InChI | InChI=1S/C13H20FN3O2S.ClH/c14-11-6-12(9-16-8-11)20(18,19)17-13(7-15)10-4-2-1-3-5-10;/h6,8-10,13,17H,1-5,7,15H2;1H |
| InChIKey | KVBOUAUABARTJQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |