C13H18Br2N2OS — CID 103807076
N-(2-amino-1-cyclohexylethyl)-2,5-dibromothiophene-3-carboxamide (PubChem CID 103807076) has the molecular formula C13H18Br2N2OS and a molecular weight of 410.18 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-2,5-dibromothiophene-3-carboxamide.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-2,5-dibromothiophene-3-carboxamide |
|---|---|
| PubChem CID | 103807076 |
| Molecular Formula | C13H18Br2N2OS |
| Molecular Weight | 410.18 g/mol |
| Exact Mass | 407.95 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-2,5-dibromothiophene-3-carboxamide |
| SMILES | NCC(NC(=O)c1cc(Br)sc1Br)C1CCCCC1 |
| InChI | InChI=1S/C13H18Br2N2OS/c14-11-6-9(12(15)19-11)13(18)17-10(7-16)8-4-2-1-3-5-8/h6,8,10H,1-5,7,16H2,(H,17,18) |
| InChIKey | VNWOMGMAUGERGT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.18 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |