C19H20N8O3 — CID 55803031
5-methyl-1-(3-nitrophenyl)-N-(1-pyrimidin-2-ylpiperidin-3-yl)triazole-4-carboxamide (PubChem CID 55803031) has the molecular formula C19H20N8O3 and a molecular weight of 408.42 g/mol. Its IUPAC name is 5-methyl-1-(3-nitrophenyl)-N-(1-pyrimidin-2-ylpiperidin-3-yl)triazole-4-carboxamide.
| Compound Name | 5-methyl-1-(3-nitrophenyl)-N-(1-pyrimidin-2-ylpiperidin-3-yl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 55803031 |
| Molecular Formula | C19H20N8O3 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 5-methyl-1-(3-nitrophenyl)-N-(1-pyrimidin-2-ylpiperidin-3-yl)triazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NC2CCCN(c3ncccn3)C2)nnn1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H20N8O3/c1-13-17(23-24-26(13)15-6-2-7-16(11-15)27(29)30)18(28)22-14-5-3-10-25(12-14)19-20-8-4-9-21-19/h2,4,6-9,11,14H,3,5,10,12H2,1H3,(H,22,28) |
| InChIKey | ZZGHMHYIXCYPIQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 131.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|