C21H21N5O3 — CID 55890576
[5-methyl-1-(3-nitrophenyl)triazol-4-yl]-[2-(2-methylphenyl)pyrrolidin-1-yl]methanone (PubChem CID 55890576) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is [5-methyl-1-(3-nitrophenyl)triazol-4-yl]-[2-(2-methylphenyl)pyrrolidin-1-yl]methanone.
| Compound Name | [5-methyl-1-(3-nitrophenyl)triazol-4-yl]-[2-(2-methylphenyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 55890576 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | [5-methyl-1-(3-nitrophenyl)triazol-4-yl]-[2-(2-methylphenyl)pyrrolidin-1-yl]methanone |
| SMILES | Cc1ccccc1C1CCCN1C(=O)c1nnn(-c2cccc([N+](=O)[O-])c2)c1C |
| InChI | InChI=1S/C21H21N5O3/c1-14-7-3-4-10-18(14)19-11-6-12-24(19)21(27)20-15(2)25(23-22-20)16-8-5-9-17(13-16)26(28)29/h3-5,7-10,13,19H,6,11-12H2,1-2H3 |
| InChIKey | CSSLUIHBZWIQLG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|