C22H20N6O3S — CID 134038688
[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]methanone (PubChem CID 134038688) has the molecular formula C22H20N6O3S and a molecular weight of 448.51 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]methanone.
| Compound Name | [2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]methanone |
|---|---|
| PubChem CID | 134038688 |
| Molecular Formula | C22H20N6O3S |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | [2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]methanone |
| SMILES | Cc1c(C(=O)N2CCCCC2c2nc3ccccc3s2)nnn1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H20N6O3S/c1-14-20(24-25-27(14)15-7-6-8-16(13-15)28(30)31)22(29)26-12-5-4-10-18(26)21-23-17-9-2-3-11-19(17)32-21/h2-3,6-9,11,13,18H,4-5,10,12H2,1H3 |
| InChIKey | VFBFMFIXFAWSEJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|