C20H23N5O5 — CID 55513691
methyl 1-[5-methyl-1-(3-nitrophenyl)triazole-4-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 55513691) has the molecular formula C20H23N5O5 and a molecular weight of 413.43 g/mol. Its IUPAC name is methyl 1-[5-methyl-1-(3-nitrophenyl)triazole-4-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | methyl 1-[5-methyl-1-(3-nitrophenyl)triazole-4-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 55513691 |
| Molecular Formula | C20H23N5O5 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | methyl 1-[5-methyl-1-(3-nitrophenyl)triazole-4-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | COC(=O)C1CC2CCCCC2N1C(=O)c1nnn(-c2cccc([N+](=O)[O-])c2)c1C |
| InChI | InChI=1S/C20H23N5O5/c1-12-18(21-22-24(12)14-7-5-8-15(11-14)25(28)29)19(26)23-16-9-4-3-6-13(16)10-17(23)20(27)30-2/h5,7-8,11,13,16-17H,3-4,6,9-10H2,1-2H3 |
| InChIKey | IOGDDJUGRHHELI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 120.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|