C14H14Cl3N5O3 — CID 119451296
1-(2,6-dichloro-4-nitrophenyl)-N-pyrrolidin-3-ylpyrazole-3-carboxamide;hydrochloride (PubChem CID 119451296) has the molecular formula C14H14Cl3N5O3 and a molecular weight of 406.66 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-nitrophenyl)-N-pyrrolidin-3-ylpyrazole-3-carboxamide;hydrochloride.
| Compound Name | 1-(2,6-dichloro-4-nitrophenyl)-N-pyrrolidin-3-ylpyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119451296 |
| Molecular Formula | C14H14Cl3N5O3 |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | 1-(2,6-dichloro-4-nitrophenyl)-N-pyrrolidin-3-ylpyrazole-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCNC1)c1ccn(-c2c(Cl)cc([N+](=O)[O-])cc2Cl)n1 |
| InChI | InChI=1S/C14H13Cl2N5O3.ClH/c15-10-5-9(21(23)24)6-11(16)13(10)20-4-2-12(19-20)14(22)18-8-1-3-17-7-8;/h2,4-6,8,17H,1,3,7H2,(H,18,22);1H |
| InChIKey | FVIIWRZHHIFHNE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|