C15H17Cl2N5O3 — CID 120650047
1-(2,6-dichloro-4-nitrophenyl)-N-[(2R)-2-(ethylamino)propyl]pyrazole-3-carboxamide (PubChem CID 120650047) has the molecular formula C15H17Cl2N5O3 and a molecular weight of 386.24 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-nitrophenyl)-N-[(2R)-2-(ethylamino)propyl]pyrazole-3-carboxamide.
| Compound Name | 1-(2,6-dichloro-4-nitrophenyl)-N-[(2R)-2-(ethylamino)propyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 120650047 |
| Molecular Formula | C15H17Cl2N5O3 |
| Molecular Weight | 386.24 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 1-(2,6-dichloro-4-nitrophenyl)-N-[(2R)-2-(ethylamino)propyl]pyrazole-3-carboxamide |
| SMILES | CCN[C@H](C)CNC(=O)c1ccn(-c2c(Cl)cc([N+](=O)[O-])cc2Cl)n1 |
| InChI | InChI=1S/C15H17Cl2N5O3/c1-3-18-9(2)8-19-15(23)13-4-5-21(20-13)14-11(16)6-10(22(24)25)7-12(14)17/h4-7,9,18H,3,8H2,1-2H3,(H,19,23)/t9-/m1/s1 |
| InChIKey | BWXDGAXIUIHWNO-SECBINFHSA-N |
| XLogP | 2.82 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|